C14H17FN2O6 — CID 68639140
2-[(4-fluoro-2-nitrophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid (PubChem CID 68639140) has the molecular formula C14H17FN2O6 and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-[(4-fluoro-2-nitrophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid.
| Compound Name | 2-[(4-fluoro-2-nitrophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 68639140 |
| Molecular Formula | C14H17FN2O6 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[(4-fluoro-2-nitrophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
| SMILES | CC(C)(C)OC(=O)N(CC(=O)O)Cc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17FN2O6/c1-14(2,3)23-13(20)16(8-12(18)19)7-9-4-5-10(15)6-11(9)17(21)22/h4-6H,7-8H2,1-3H3,(H,18,19) |
| InChIKey | DUIVRTGDVWQELW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|