C19H27BrN2O6 — CID 141255641
5-[(4-bromo-2-nitrophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl acetate (PubChem CID 141255641) has the molecular formula C19H27BrN2O6 and a molecular weight of 459.34 g/mol. Its IUPAC name is 5-[(4-bromo-2-nitrophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl acetate.
| Compound Name | 5-[(4-bromo-2-nitrophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl acetate |
|---|---|
| PubChem CID | 141255641 |
| Molecular Formula | C19H27BrN2O6 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 5-[(4-bromo-2-nitrophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl acetate |
| SMILES | CC(=O)OCCCCCN(Cc1ccc(Br)cc1[N+](=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27BrN2O6/c1-14(23)27-11-7-5-6-10-21(18(24)28-19(2,3)4)13-15-8-9-16(20)12-17(15)22(25)26/h8-9,12H,5-7,10-11,13H2,1-4H3 |
| InChIKey | OSQLBDGQRGUNSL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|