C16H23N3O5 — CID 70074986
tert-butyl N-[3-(3-acetyl-4-nitrophenyl)propyl]-N-aminocarbamate (PubChem CID 70074986) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is tert-butyl N-[3-(3-acetyl-4-nitrophenyl)propyl]-N-aminocarbamate.
| Compound Name | tert-butyl N-[3-(3-acetyl-4-nitrophenyl)propyl]-N-aminocarbamate |
|---|---|
| PubChem CID | 70074986 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | tert-butyl N-[3-(3-acetyl-4-nitrophenyl)propyl]-N-aminocarbamate |
| SMILES | CC(=O)c1cc(CCCN(N)C(=O)OC(C)(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N3O5/c1-11(20)13-10-12(7-8-14(13)19(22)23)6-5-9-18(17)15(21)24-16(2,3)4/h7-8,10H,5-6,9,17H2,1-4H3 |
| InChIKey | OPTJPMNVRCLOST-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|