C22H34N6O7 — CID 67686133
tert-butyl 5-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-nitrobenzoate (PubChem CID 67686133) has the molecular formula C22H34N6O7 and a molecular weight of 494.55 g/mol. Its IUPAC name is tert-butyl 5-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-nitrobenzoate.
| Compound Name | tert-butyl 5-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-nitrobenzoate |
|---|---|
| PubChem CID | 67686133 |
| Molecular Formula | C22H34N6O7 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | tert-butyl 5-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-nitrobenzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(N(C(=O)OC(C)(C)C)C(=O)[C@@H](N)CCCN=C(N)N)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H34N6O7/c1-21(2,3)34-18(30)14-12-13(9-10-16(14)28(32)33)27(20(31)35-22(4,5)6)17(29)15(23)8-7-11-26-19(24)25/h9-10,12,15H,7-8,11,23H2,1-6H3,(H4,24,25,26)/t15-/m0/s1 |
| InChIKey | VXOIFUJBRLQDCV-HNNXBMFYSA-N |
| XLogP | 2.20 |
| TPSA | 206.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|