C16H32N6O5 — CID 86733912
tert-butyl N-[(2S)-1-[butyl(methyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-nitrocarbamate (PubChem CID 86733912) has the molecular formula C16H32N6O5 and a molecular weight of 388.47 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[butyl(methyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-nitrocarbamate.
| Compound Name | tert-butyl N-[(2S)-1-[butyl(methyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-nitrocarbamate |
|---|---|
| PubChem CID | 86733912 |
| Molecular Formula | C16H32N6O5 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-[butyl(methyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-nitrocarbamate |
| SMILES | CCCCN(C)C(=O)[C@H](CCCN=C(N)N)N(C(=O)OC(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C16H32N6O5/c1-6-7-11-20(5)13(23)12(9-8-10-19-14(17)18)21(22(25)26)15(24)27-16(2,3)4/h12H,6-11H2,1-5H3,(H4,17,18,19)/t12-/m0/s1 |
| InChIKey | MWCKVGOSOJVIKF-LBPRGKRZSA-N |
| XLogP | 1.10 |
| TPSA | 157.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|