C13H25N3O3 — CID 159829836
tert-butyl 3-acetyl-6-(diaminomethylideneamino)hexanoate (PubChem CID 159829836) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl 3-acetyl-6-(diaminomethylideneamino)hexanoate.
| Compound Name | tert-butyl 3-acetyl-6-(diaminomethylideneamino)hexanoate |
|---|---|
| PubChem CID | 159829836 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | tert-butyl 3-acetyl-6-(diaminomethylideneamino)hexanoate |
| SMILES | CC(=O)C(CCCN=C(N)N)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25N3O3/c1-9(17)10(6-5-7-16-12(14)15)8-11(18)19-13(2,3)4/h10H,5-8H2,1-4H3,(H4,14,15,16) |
| InChIKey | FCPWUGHLTHPEOL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|