C25H39N9O8 — CID 142254488
tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-5-amino-4-(4-aminophenyl)-3,5-dioxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-nitroamino]-1-oxopropan-2-yl]carbamate (PubChem CID 142254488) has the molecular formula C25H39N9O8 and a molecular weight of 593.64 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-5-amino-4-(4-aminophenyl)-3,5-dioxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-nitroamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-5-amino-4-(4-aminophenyl)-3,5-dioxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-nitroamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 142254488 |
| Molecular Formula | C25H39N9O8 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-5-amino-4-(4-aminophenyl)-3,5-dioxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-nitroamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)[C@H](CCCN=C(N)N)N(C(=O)[C@H](C)NC(=O)OC(C)(C)C)[N+](=O)[O-])C(=O)C(C(N)=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C25H39N9O8/c1-13(19(35)18(20(27)36)15-8-10-16(26)11-9-15)31-21(37)17(7-6-12-30-23(28)29)33(34(40)41)22(38)14(2)32-24(39)42-25(3,4)5/h8-11,13-14,17-18H,6-7,12,26H2,1-5H3,(H2,27,36)(H,31,37)(H,32,39)(H4,28,29,30)/t13-,14-,17-,18?/m0/s1 |
| InChIKey | NIBOVNXWEHMBSX-RDAOOHMSSA-N |
| XLogP | -0.73 |
| TPSA | 281.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|