C21H34N7O9P — CID 54545009
[(1R)-1-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]-nitroamino]pentanoyl]amino]ethyl]phosphonic acid (PubChem CID 54545009) has the molecular formula C21H34N7O9P and a molecular weight of 559.52 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]-nitroamino]pentanoyl]amino]ethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]-nitroamino]pentanoyl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 54545009 |
| Molecular Formula | C21H34N7O9P |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]-nitroamino]pentanoyl]amino]ethyl]phosphonic acid |
| SMILES | CCC[C@@H](C(=O)N[C@@H](C)P(=O)(O)O)N(C(=O)[C@H](CCCN=C(N)N)NC(=O)OCc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C21H34N7O9P/c1-3-8-17(18(29)25-14(2)38(34,35)36)27(28(32)33)19(30)16(11-7-12-24-20(22)23)26-21(31)37-13-15-9-5-4-6-10-15/h4-6,9-10,14,16-17H,3,7-8,11-13H2,1-2H3,(H,25,29)(H,26,31)(H4,22,23,24)(H2,34,35,36)/t14-,16+,17+/m1/s1 |
| InChIKey | ZFXHSPSKBBXVKX-PVAVHDDUSA-N |
| XLogP | 0.16 |
| TPSA | 252.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|