C19H30N7O9P — CID 70558744
[(1R)-1-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]-nitroamino]propanoyl]amino]ethyl]phosphonic acid (PubChem CID 70558744) has the molecular formula C19H30N7O9P and a molecular weight of 531.46 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]-nitroamino]propanoyl]amino]ethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]-nitroamino]propanoyl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 70558744 |
| Molecular Formula | C19H30N7O9P |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]-nitroamino]propanoyl]amino]ethyl]phosphonic acid |
| SMILES | C[C@H](NC(=O)[C@H](C)N(C(=O)[C@H](CCCN=C(N)N)NC(=O)OCc1ccccc1)[N+](=O)[O-])P(=O)(O)O |
| InChI | InChI=1S/C19H30N7O9P/c1-12(16(27)23-13(2)36(32,33)34)25(26(30)31)17(28)15(9-6-10-22-18(20)21)24-19(29)35-11-14-7-4-3-5-8-14/h3-5,7-8,12-13,15H,6,9-11H2,1-2H3,(H,23,27)(H,24,29)(H4,20,21,22)(H2,32,33,34)/t12-,13+,15-/m0/s1 |
| InChIKey | NZSCPVFLNVNJQM-GUTXKFCHSA-N |
| XLogP | -0.62 |
| TPSA | 252.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|