C17H26N6O5 — CID 70467540
tert-butyl N-[(2S)-1-(2-amino-5-nitrophenyl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate (PubChem CID 70467540) has the molecular formula C17H26N6O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-amino-5-nitrophenyl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-amino-5-nitrophenyl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 70467540 |
| Molecular Formula | C17H26N6O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-amino-5-nitrophenyl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN=C(N)N)C(=O)c1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C17H26N6O5/c1-17(2,3)28-16(25)22-13(5-4-8-21-15(19)20)14(24)11-9-10(23(26)27)6-7-12(11)18/h6-7,9,13H,4-5,8,18H2,1-3H3,(H,22,25)(H4,19,20,21)/t13-/m0/s1 |
| InChIKey | JSOXVKNYLHUONN-ZDUSSCGKSA-N |
| XLogP | 1.31 |
| TPSA | 188.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|