C24H39N9O6 — CID 101012705
2-amino-N-[(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-5-nitrobenzamide (PubChem CID 101012705) has the molecular formula C24H39N9O6 and a molecular weight of 549.63 g/mol. Its IUPAC name is 2-amino-N-[(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-5-nitrobenzamide.
| Compound Name | 2-amino-N-[(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 101012705 |
| Molecular Formula | C24H39N9O6 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | 2-amino-N-[(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-5-nitrobenzamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](N)C(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NC(=O)c1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C24H39N9O6/c1-12(2)10-18(31-23(37)19(26)13(3)4)22(36)30-17(6-5-9-29-24(27)28)21(35)32-20(34)15-11-14(33(38)39)7-8-16(15)25/h7-8,11-13,17-19H,5-6,9-10,25-26H2,1-4H3,(H,30,36)(H,31,37)(H4,27,28,29)(H,32,34,35)/t17-,18-,19+/m0/s1 |
| InChIKey | GFGCMUSRGKROQW-GBESFXJTSA-N |
| XLogP | -0.51 |
| TPSA | 263.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|