C22H37N7O4 — CID 174793872
2-amino-N-(2-amino-3-methylbutanoyl)-5-(diaminomethylideneamino)-N-(4-nitro-2-pentylphenyl)pentanamide (PubChem CID 174793872) has the molecular formula C22H37N7O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-amino-N-(2-amino-3-methylbutanoyl)-5-(diaminomethylideneamino)-N-(4-nitro-2-pentylphenyl)pentanamide.
| Compound Name | 2-amino-N-(2-amino-3-methylbutanoyl)-5-(diaminomethylideneamino)-N-(4-nitro-2-pentylphenyl)pentanamide |
|---|---|
| PubChem CID | 174793872 |
| Molecular Formula | C22H37N7O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 2-amino-N-(2-amino-3-methylbutanoyl)-5-(diaminomethylideneamino)-N-(4-nitro-2-pentylphenyl)pentanamide |
| SMILES | CCCCCc1cc([N+](=O)[O-])ccc1N(C(=O)C(N)CCCN=C(N)N)C(=O)C(N)C(C)C |
| InChI | InChI=1S/C22H37N7O4/c1-4-5-6-8-15-13-16(29(32)33)10-11-18(15)28(21(31)19(24)14(2)3)20(30)17(23)9-7-12-27-22(25)26/h10-11,13-14,17,19H,4-9,12,23-24H2,1-3H3,(H4,25,26,27) |
| InChIKey | BOGLHHDLYAZWQC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 196.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|