C20H30N6O5 — CID 54439233
(2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-[2-(4-nitrophenyl)acetyl]pentanamide (PubChem CID 54439233) has the molecular formula C20H30N6O5 and a molecular weight of 434.50 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-[2-(4-nitrophenyl)acetyl]pentanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-[2-(4-nitrophenyl)acetyl]pentanamide |
|---|---|
| PubChem CID | 54439233 |
| Molecular Formula | C20H30N6O5 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-[2-(4-nitrophenyl)acetyl]pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N(C(=O)Cc1ccc([N+](=O)[O-])cc1)[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C20H30N6O5/c1-13(2)10-17(21)19(29)25(16(12-27)4-3-9-24-20(22)23)18(28)11-14-5-7-15(8-6-14)26(30)31/h5-8,12-13,16-17H,3-4,9-11,21H2,1-2H3,(H4,22,23,24)/t16-,17-/m0/s1 |
| InChIKey | WMXHQGYEJPBSNF-IRXDYDNUSA-N |
| XLogP | 0.49 |
| TPSA | 188.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|