C12H24N6O4 — CID 54411499
(2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-4-methyl-1-oxopentan-2-yl]-N-nitropentanamide (PubChem CID 54411499) has the molecular formula C12H24N6O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-4-methyl-1-oxopentan-2-yl]-N-nitropentanamide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-4-methyl-1-oxopentan-2-yl]-N-nitropentanamide |
|---|---|
| PubChem CID | 54411499 |
| Molecular Formula | C12H24N6O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-4-methyl-1-oxopentan-2-yl]-N-nitropentanamide |
| SMILES | CC(C)C[C@@H](C=O)N(C(=O)[C@@H](N)CCCN=C(N)N)[N+](=O)[O-] |
| InChI | InChI=1S/C12H24N6O4/c1-8(2)6-9(7-19)17(18(21)22)11(20)10(13)4-3-5-16-12(14)15/h7-10H,3-6,13H2,1-2H3,(H4,14,15,16)/t9-,10-/m0/s1 |
| InChIKey | VULSRHOAOOSTPV-UWVGGRQHSA-N |
| XLogP | -1.00 |
| TPSA | 170.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|