C19H32ClN5O4S — CID 88731386
(2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-(4-methylphenyl)sulfonylpentanamide;hydrochloride (PubChem CID 88731386) has the molecular formula C19H32ClN5O4S and a molecular weight of 462.02 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-(4-methylphenyl)sulfonylpentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-(4-methylphenyl)sulfonylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 88731386 |
| Molecular Formula | C19H32ClN5O4S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-(4-methylphenyl)sulfonylpentanamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)[C@@H](N)CC(C)C)[C@H](C=O)CCCN=C(N)N)cc1.Cl |
| InChI | InChI=1S/C19H31N5O4S.ClH/c1-13(2)11-17(20)18(26)24(15(12-25)5-4-10-23-19(21)22)29(27,28)16-8-6-14(3)7-9-16;/h6-9,12-13,15,17H,4-5,10-11,20H2,1-3H3,(H4,21,22,23);1H/t15-,17-;/m0./s1 |
| InChIKey | NAVUAHWMRSCBBM-NBLXOJGSSA-N |
| XLogP | 0.93 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|