C18H31ClN6O2 — CID 88731396
(2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-(pyridin-3-ylmethyl)pentanamide;hydrochloride (PubChem CID 88731396) has the molecular formula C18H31ClN6O2 and a molecular weight of 398.94 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-(pyridin-3-ylmethyl)pentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-(pyridin-3-ylmethyl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 88731396 |
| Molecular Formula | C18H31ClN6O2 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methyl-N-(pyridin-3-ylmethyl)pentanamide;hydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)N(Cc1cccnc1)[C@H](C=O)CCCN=C(N)N.Cl |
| InChI | InChI=1S/C18H30N6O2.ClH/c1-13(2)9-16(19)17(26)24(11-14-5-3-7-22-10-14)15(12-25)6-4-8-23-18(20)21;/h3,5,7,10,12-13,15-16H,4,6,8-9,11,19H2,1-2H3,(H4,20,21,23);1H/t15-,16-;/m0./s1 |
| InChIKey | KGZQWZROEJZABC-MOGJOVFKSA-N |
| XLogP | 0.83 |
| TPSA | 140.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|