C20H32ClN5O4 — CID 88731301
(2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-[2-(2-hydroxyphenyl)acetyl]-4-methylpentanamide;hydrochloride (PubChem CID 88731301) has the molecular formula C20H32ClN5O4 and a molecular weight of 441.96 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-[2-(2-hydroxyphenyl)acetyl]-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-[2-(2-hydroxyphenyl)acetyl]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 88731301 |
| Molecular Formula | C20H32ClN5O4 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-[2-(2-hydroxyphenyl)acetyl]-4-methylpentanamide;hydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)N(C(=O)Cc1ccccc1O)[C@H](C=O)CCCN=C(N)N.Cl |
| InChI | InChI=1S/C20H31N5O4.ClH/c1-13(2)10-16(21)19(29)25(15(12-26)7-5-9-24-20(22)23)18(28)11-14-6-3-4-8-17(14)27;/h3-4,6,8,12-13,15-16,27H,5,7,9-11,21H2,1-2H3,(H4,22,23,24);1H/t15-,16-;/m0./s1 |
| InChIKey | MXGANVIMINSSCR-MOGJOVFKSA-N |
| XLogP | 0.71 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|