C18H39N5O4 — CID 87743939
2-amino-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;1,1-diethoxyethane (PubChem CID 87743939) has the molecular formula C18H39N5O4 and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-amino-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;1,1-diethoxyethane.
| Compound Name | 2-amino-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;1,1-diethoxyethane |
|---|---|
| PubChem CID | 87743939 |
| Molecular Formula | C18H39N5O4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | 2-amino-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;1,1-diethoxyethane |
| SMILES | CC(C)CC(N)C(=O)NC(C=O)CCCN=C(N)N.CCOC(C)OCC |
| InChI | InChI=1S/C12H25N5O2.C6H14O2/c1-8(2)6-10(13)11(19)17-9(7-18)4-3-5-16-12(14)15;1-4-7-6(3)8-5-2/h7-10H,3-6,13H2,1-2H3,(H,17,19)(H4,14,15,16);6H,4-5H2,1-3H3 |
| InChIKey | ATVLSJCAYIHTIX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 155.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|