C24H46N8O6 — CID 23462828
methyl 2-[[2-[[5-amino-2-[(2-amino-4-methylpentanoyl)amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoate (PubChem CID 23462828) has the molecular formula C24H46N8O6 and a molecular weight of 542.68 g/mol. Its IUPAC name is methyl 2-[[2-[[5-amino-2-[(2-amino-4-methylpentanoyl)amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[2-[[5-amino-2-[(2-amino-4-methylpentanoyl)amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 23462828 |
| Molecular Formula | C24H46N8O6 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | methyl 2-[[2-[[5-amino-2-[(2-amino-4-methylpentanoyl)amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C(CCCN=C(N)N)NC(=O)C(CCC(N)=O)NC(=O)C(N)CC(C)C |
| InChI | InChI=1S/C24H46N8O6/c1-13(2)11-15(25)20(34)30-17(8-9-19(26)33)22(36)31-16(7-6-10-29-24(27)28)21(35)32-18(12-14(3)4)23(37)38-5/h13-18H,6-12,25H2,1-5H3,(H2,26,33)(H,30,34)(H,31,36)(H,32,35)(H4,27,28,29) |
| InChIKey | JJDNXZJZHNNUTL-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 247.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|