C19H31Cl2N5O2 — CID 88731474
(2S)-2-amino-N-[(3-chlorophenyl)methyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;hydrochloride (PubChem CID 88731474) has the molecular formula C19H31Cl2N5O2 and a molecular weight of 432.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3-chlorophenyl)methyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[(3-chlorophenyl)methyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 88731474 |
| Molecular Formula | C19H31Cl2N5O2 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (2S)-2-amino-N-[(3-chlorophenyl)methyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;hydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)N(Cc1cccc(Cl)c1)[C@H](C=O)CCCN=C(N)N.Cl |
| InChI | InChI=1S/C19H30ClN5O2.ClH/c1-13(2)9-17(21)18(27)25(11-14-5-3-6-15(20)10-14)16(12-26)7-4-8-24-19(22)23;/h3,5-6,10,12-13,16-17H,4,7-9,11,21H2,1-2H3,(H4,22,23,24);1H/t16-,17-;/m0./s1 |
| InChIKey | YVRCCEBOZBIHNI-QJHJCNPRSA-N |
| XLogP | 2.08 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|