C22H29N5O5S — CID 118276301
2-[(2-amino-3-phenylpropanoyl)-(4-methylphenyl)sulfonylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 118276301) has the molecular formula C22H29N5O5S and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-[(2-amino-3-phenylpropanoyl)-(4-methylphenyl)sulfonylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[(2-amino-3-phenylpropanoyl)-(4-methylphenyl)sulfonylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 118276301 |
| Molecular Formula | C22H29N5O5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-[(2-amino-3-phenylpropanoyl)-(4-methylphenyl)sulfonylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)C(N)Cc2ccccc2)C(CCCN=C(N)N)C(=O)O)cc1 |
| InChI | InChI=1S/C22H29N5O5S/c1-15-9-11-17(12-10-15)33(31,32)27(19(21(29)30)8-5-13-26-22(24)25)20(28)18(23)14-16-6-3-2-4-7-16/h2-4,6-7,9-12,18-19H,5,8,13-14,23H2,1H3,(H,29,30)(H4,24,25,26) |
| InChIKey | DSUOOIXTMXYFOF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|