C33H40N8O6 — CID 174283981
2-amino-N-(2-amino-3-methylbutanoyl)-N-[2-(2-amino-3-phenylpropanoyl)-3-benzoyl-4-nitrophenyl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 174283981) has the molecular formula C33H40N8O6 and a molecular weight of 644.73 g/mol. Its IUPAC name is 2-amino-N-(2-amino-3-methylbutanoyl)-N-[2-(2-amino-3-phenylpropanoyl)-3-benzoyl-4-nitrophenyl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | 2-amino-N-(2-amino-3-methylbutanoyl)-N-[2-(2-amino-3-phenylpropanoyl)-3-benzoyl-4-nitrophenyl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 174283981 |
| Molecular Formula | C33H40N8O6 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | 2-amino-N-(2-amino-3-methylbutanoyl)-N-[2-(2-amino-3-phenylpropanoyl)-3-benzoyl-4-nitrophenyl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | CC(C)C(N)C(=O)N(C(=O)C(N)CCCN=C(N)N)c1ccc([N+](=O)[O-])c(C(=O)c2ccccc2)c1C(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C33H40N8O6/c1-19(2)28(36)32(45)40(31(44)22(34)14-9-17-39-33(37)38)24-15-16-25(41(46)47)27(29(42)21-12-7-4-8-13-21)26(24)30(43)23(35)18-20-10-5-3-6-11-20/h3-8,10-13,15-16,19,22-23,28H,9,14,17-18,34-36H2,1-2H3,(H4,37,38,39) |
| InChIKey | MJGHILGHHQZJOJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 257.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|