About (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone
(3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone (PubChem CID 158514561) has the molecular formula C20H20N2O9
and a molecular weight of 432.39 g/mol. Its IUPAC name is (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone.
Molecular Properties
| Compound Name | (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone |
| PubChem CID | 158514561 |
| Molecular Formula | C20H20N2O9 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone |
| SMILES | CC(=O)OCc1ccc([N+](=O)[O-])c(C(C)=O)c1.CC(=O)c1cc(CO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11NO5.C9H9NO4/c1-7(13)10-5-9(6-17-8(2)14)3-4-11(10)12(15)16;1-6(12)8-4-7(5-11)2-3-9(8)10(13)14/h3-5H,6H2,1-2H3;2-4,11H,5H2,1H3 |
| InChIKey | HLLXFVDJMBUKCX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 166.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone?
The IUPAC name of (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone (CID 158514561) is (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone.
What is the SMILES notation for (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone?
The canonical SMILES for (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone is CC(=O)OCc1ccc([N+](=O)[O-])c(C(C)=O)c1.CC(=O)c1cc(CO)ccc1[N+](=O)[O-].
What is the InChIKey of (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone?
The InChIKey is HLLXFVDJMBUKCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO5.C9H9NO4/c1-7(13)10-5-9(6-17-8(2)14)3-4-11(10)12(15)16;1-6(12)8-4-7(5-11)2-3-9(8)10(13)14/h3-5H,6H2,1-2H3;2-4,11H,5H2,1H3.
What are the key properties of (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone?
(3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone has a molecular weight of 432.39 g/mol, XLogP of 3.15, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyl-4-nitrophenyl)methyl acetate;1-[5-(hydroxymethyl)-2-nitrophenyl]ethanone is sourced from PubChem (CID 158514561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).