C17H21FN2O9 — CID 170166392
2-(4-fluoro-2-nitrophenoxy)-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioic acid (PubChem CID 170166392) has the molecular formula C17H21FN2O9 and a molecular weight of 416.36 g/mol. Its IUPAC name is 2-(4-fluoro-2-nitrophenoxy)-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioic acid.
| Compound Name | 2-(4-fluoro-2-nitrophenoxy)-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 170166392 |
| Molecular Formula | C17H21FN2O9 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-(4-fluoro-2-nitrophenoxy)-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioic acid |
| SMILES | CN(C(=O)OC(C)(C)C)C(CC(Oc1ccc(F)cc1[N+](=O)[O-])C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H21FN2O9/c1-17(2,3)29-16(25)19(4)11(14(21)22)8-13(15(23)24)28-12-6-5-9(18)7-10(12)20(26)27/h5-7,11,13H,8H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | DNXMQGGDAGTOBQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 156.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|