C30H27FN2O5 — CID 67076837
(2S,3S)-2-(dibenzylamino)-3-(4-fluoro-2-nitrophenoxy)-4-phenylbutanoic acid (PubChem CID 67076837) has the molecular formula C30H27FN2O5 and a molecular weight of 514.55 g/mol. Its IUPAC name is (2S,3S)-2-(dibenzylamino)-3-(4-fluoro-2-nitrophenoxy)-4-phenylbutanoic acid.
| Compound Name | (2S,3S)-2-(dibenzylamino)-3-(4-fluoro-2-nitrophenoxy)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 67076837 |
| Molecular Formula | C30H27FN2O5 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | (2S,3S)-2-(dibenzylamino)-3-(4-fluoro-2-nitrophenoxy)-4-phenylbutanoic acid |
| SMILES | O=C(O)[C@H]([C@H](Cc1ccccc1)Oc1ccc(F)cc1[N+](=O)[O-])N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H27FN2O5/c31-25-16-17-27(26(19-25)33(36)37)38-28(18-22-10-4-1-5-11-22)29(30(34)35)32(20-23-12-6-2-7-13-23)21-24-14-8-3-9-15-24/h1-17,19,28-29H,18,20-21H2,(H,34,35)/t28-,29-/m0/s1 |
| InChIKey | NZRYWMDQXKLUJK-VMPREFPWSA-N |
| XLogP | 5.88 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|