C32H31FN2O6 — CID 67077114
(2R,3S)-2-(dibenzylamino)-3-(4-fluoro-2-nitrophenoxy)-5-phenylmethoxypentanoic acid (PubChem CID 67077114) has the molecular formula C32H31FN2O6 and a molecular weight of 558.61 g/mol. Its IUPAC name is (2R,3S)-2-(dibenzylamino)-3-(4-fluoro-2-nitrophenoxy)-5-phenylmethoxypentanoic acid.
| Compound Name | (2R,3S)-2-(dibenzylamino)-3-(4-fluoro-2-nitrophenoxy)-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 67077114 |
| Molecular Formula | C32H31FN2O6 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | (2R,3S)-2-(dibenzylamino)-3-(4-fluoro-2-nitrophenoxy)-5-phenylmethoxypentanoic acid |
| SMILES | O=C(O)[C@@H]([C@H](CCOCc1ccccc1)Oc1ccc(F)cc1[N+](=O)[O-])N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H31FN2O6/c33-27-16-17-29(28(20-27)35(38)39)41-30(18-19-40-23-26-14-8-3-9-15-26)31(32(36)37)34(21-24-10-4-1-5-11-24)22-25-12-6-2-7-13-25/h1-17,20,30-31H,18-19,21-23H2,(H,36,37)/t30-,31+/m0/s1 |
| InChIKey | GHIPRRMHMRUQMX-IOWSJCHKSA-N |
| XLogP | 6.24 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|