C14H19NO4 — CID 55021233
1-(2,4-dimethyl-6-nitrophenoxy)-3,3-dimethylbutan-2-one (PubChem CID 55021233) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-(2,4-dimethyl-6-nitrophenoxy)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(2,4-dimethyl-6-nitrophenoxy)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 55021233 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-(2,4-dimethyl-6-nitrophenoxy)-3,3-dimethylbutan-2-one |
| SMILES | Cc1cc(C)c(OCC(=O)C(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H19NO4/c1-9-6-10(2)13(11(7-9)15(17)18)19-8-12(16)14(3,4)5/h6-7H,8H2,1-5H3 |
| InChIKey | OQBNQVRVMSOKJM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|