C15H21N3O3 — CID 62097689
2-amino-6-(2,4-dimethyl-6-nitrophenoxy)-2-methylhexanenitrile (PubChem CID 62097689) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-amino-6-(2,4-dimethyl-6-nitrophenoxy)-2-methylhexanenitrile.
| Compound Name | 2-amino-6-(2,4-dimethyl-6-nitrophenoxy)-2-methylhexanenitrile |
|---|---|
| PubChem CID | 62097689 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-amino-6-(2,4-dimethyl-6-nitrophenoxy)-2-methylhexanenitrile |
| SMILES | Cc1cc(C)c(OCCCCC(C)(N)C#N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H21N3O3/c1-11-8-12(2)14(13(9-11)18(19)20)21-7-5-4-6-15(3,17)10-16/h8-9H,4-7,17H2,1-3H3 |
| InChIKey | NYTGMDBKURSMTL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|