C14H21N3O3 — CID 65251788
4-(2,4-dimethyl-6-nitrophenoxy)-2,2-dimethylbutanimidamide (PubChem CID 65251788) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-(2,4-dimethyl-6-nitrophenoxy)-2,2-dimethylbutanimidamide.
| Compound Name | 4-(2,4-dimethyl-6-nitrophenoxy)-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 65251788 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-(2,4-dimethyl-6-nitrophenoxy)-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCOc1c(C)cc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O3/c1-9-7-10(2)12(11(8-9)17(18)19)20-6-5-14(3,4)13(15)16/h7-8H,5-6H2,1-4H3,(H3,15,16) |
| InChIKey | FFPWHEPSQYYVAX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|