C8H6Cl2N2O4 — CID 18692905
1,2-bis(chloromethyl)-3,4-dinitrobenzene (PubChem CID 18692905) has the molecular formula C8H6Cl2N2O4 and a molecular weight of 265.05 g/mol. Its IUPAC name is 1,2-bis(chloromethyl)-3,4-dinitrobenzene.
| Compound Name | 1,2-bis(chloromethyl)-3,4-dinitrobenzene |
|---|---|
| PubChem CID | 18692905 |
| Molecular Formula | C8H6Cl2N2O4 |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 1,2-bis(chloromethyl)-3,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(CCl)c(CCl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6Cl2N2O4/c9-3-5-1-2-7(11(13)14)8(12(15)16)6(5)4-10/h1-2H,3-4H2 |
| InChIKey | FQXWCTPSXPDXPG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|