C9H4ClF6NO2 — CID 118809830
1-(chloromethyl)-4-nitro-2,3-bis(trifluoromethyl)benzene (PubChem CID 118809830) has the molecular formula C9H4ClF6NO2 and a molecular weight of 307.58 g/mol. Its IUPAC name is 1-(chloromethyl)-4-nitro-2,3-bis(trifluoromethyl)benzene.
| Compound Name | 1-(chloromethyl)-4-nitro-2,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 118809830 |
| Molecular Formula | C9H4ClF6NO2 |
| Molecular Weight | 307.58 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 1-(chloromethyl)-4-nitro-2,3-bis(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(CCl)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H4ClF6NO2/c10-3-4-1-2-5(17(18)19)7(9(14,15)16)6(4)8(11,12)13/h1-2H,3H2 |
| InChIKey | JDEQENWEKJWNGA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|