C20H26N2O2 — CID 121325107
4-[deuterio-(2,3,5,6-tetramethyl-4-nitrophenyl)methyl]-2,3,5,6-tetramethylpyridine (PubChem CID 121325107) has the molecular formula C20H26N2O2 and a molecular weight of 327.45 g/mol. Its IUPAC name is 4-[deuterio-(2,3,5,6-tetramethyl-4-nitrophenyl)methyl]-2,3,5,6-tetramethylpyridine.
| Compound Name | 4-[deuterio-(2,3,5,6-tetramethyl-4-nitrophenyl)methyl]-2,3,5,6-tetramethylpyridine |
|---|---|
| PubChem CID | 121325107 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-[deuterio-(2,3,5,6-tetramethyl-4-nitrophenyl)methyl]-2,3,5,6-tetramethylpyridine |
| SMILES | [2H]C(c1c(C)c(C)nc(C)c1C)c1c(C)c(C)c([N+](=O)[O-])c(C)c1C |
| InChI | InChI=1S/C20H26N2O2/c1-10-12(3)20(22(23)24)13(4)11(2)18(10)9-19-14(5)16(7)21-17(8)15(19)6/h9H2,1-8H3/i9D |
| InChIKey | XOFIPOUCNCDMLG-QOWOAITPSA-N |
| XLogP | 5.05 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|