C8H10ClN3O3 — CID 59130439
[(2-chloro-5,6-dimethyl-3-nitro-4-pyridinyl)amino]methanol (PubChem CID 59130439) has the molecular formula C8H10ClN3O3 and a molecular weight of 231.64 g/mol. Its IUPAC name is [(2-chloro-5,6-dimethyl-3-nitro-4-pyridinyl)amino]methanol.
| Compound Name | [(2-chloro-5,6-dimethyl-3-nitro-4-pyridinyl)amino]methanol |
|---|---|
| PubChem CID | 59130439 |
| Molecular Formula | C8H10ClN3O3 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | [(2-chloro-5,6-dimethyl-3-nitro-4-pyridinyl)amino]methanol |
| SMILES | Cc1nc(Cl)c([N+](=O)[O-])c(NCO)c1C |
| InChI | InChI=1S/C8H10ClN3O3/c1-4-5(2)11-8(9)7(12(14)15)6(4)10-3-13/h13H,3H2,1-2H3,(H,10,11) |
| InChIKey | XPSOXRAOQRWLAB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|