C9H12Cl2N4O2 — CID 87963286
4,6-dichloro-5-nitro-N-pentylpyrimidin-2-amine (PubChem CID 87963286) has the molecular formula C9H12Cl2N4O2 and a molecular weight of 279.13 g/mol. Its IUPAC name is 4,6-dichloro-5-nitro-N-pentylpyrimidin-2-amine.
| Compound Name | 4,6-dichloro-5-nitro-N-pentylpyrimidin-2-amine |
|---|---|
| PubChem CID | 87963286 |
| Molecular Formula | C9H12Cl2N4O2 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 4,6-dichloro-5-nitro-N-pentylpyrimidin-2-amine |
| SMILES | CCCCCNc1nc(Cl)c([N+](=O)[O-])c(Cl)n1 |
| InChI | InChI=1S/C9H12Cl2N4O2/c1-2-3-4-5-12-9-13-7(10)6(15(16)17)8(11)14-9/h2-5H2,1H3,(H,12,13,14) |
| InChIKey | ATBGBVDXKOQIHX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|