C11H17Cl2N3O2 — CID 20569591
4-(2-chloroethyl)-N-ethyl-2,6-dimethyl-5-nitropyridin-3-amine;hydrochloride (PubChem CID 20569591) has the molecular formula C11H17Cl2N3O2 and a molecular weight of 294.18 g/mol. Its IUPAC name is 4-(2-chloroethyl)-N-ethyl-2,6-dimethyl-5-nitropyridin-3-amine;hydrochloride.
| Compound Name | 4-(2-chloroethyl)-N-ethyl-2,6-dimethyl-5-nitropyridin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 20569591 |
| Molecular Formula | C11H17Cl2N3O2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-(2-chloroethyl)-N-ethyl-2,6-dimethyl-5-nitropyridin-3-amine;hydrochloride |
| SMILES | CCNc1c(C)nc(C)c([N+](=O)[O-])c1CCCl.Cl |
| InChI | InChI=1S/C11H16ClN3O2.ClH/c1-4-13-10-7(2)14-8(3)11(15(16)17)9(10)5-6-12;/h13H,4-6H2,1-3H3;1H |
| InChIKey | VLNBUFUMQMFVJI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|