C9H12Cl2N2 — CID 609079
3,5-dichloro-N-ethyl-2,6-dimethylpyridin-4-amine (PubChem CID 609079) has the molecular formula C9H12Cl2N2 and a molecular weight of 219.11 g/mol. Its IUPAC name is 3,5-dichloro-N-ethyl-2,6-dimethylpyridin-4-amine.
| Compound Name | 3,5-dichloro-N-ethyl-2,6-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 609079 |
| Molecular Formula | C9H12Cl2N2 |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 3,5-dichloro-N-ethyl-2,6-dimethylpyridin-4-amine |
| SMILES | CCNc1c(Cl)c(C)nc(C)c1Cl |
| InChI | InChI=1S/C9H12Cl2N2/c1-4-12-9-7(10)5(2)13-6(3)8(9)11/h4H2,1-3H3,(H,12,13) |
| InChIKey | LGEGEQGAVXXRNA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |