C9H11Cl2NO — CID 605771
3,5-dichloro-4-ethoxy-2,6-dimethylpyridine (PubChem CID 605771) has the molecular formula C9H11Cl2NO and a molecular weight of 220.10 g/mol. Its IUPAC name is 3,5-dichloro-4-ethoxy-2,6-dimethylpyridine.
| Compound Name | 3,5-dichloro-4-ethoxy-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 605771 |
| Molecular Formula | C9H11Cl2NO |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 3,5-dichloro-4-ethoxy-2,6-dimethylpyridine |
| SMILES | CCOc1c(Cl)c(C)nc(C)c1Cl |
| InChI | InChI=1S/C9H11Cl2NO/c1-4-13-9-7(10)5(2)12-6(3)8(9)11/h4H2,1-3H3 |
| InChIKey | YCAKOFRZPSUGKF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |