C9H10BrCl2NO — CID 572274
4-(2-bromoethoxy)-3,5-dichloro-2,6-dimethylpyridine (PubChem CID 572274) has the molecular formula C9H10BrCl2NO and a molecular weight of 299.00 g/mol. Its IUPAC name is 4-(2-bromoethoxy)-3,5-dichloro-2,6-dimethylpyridine.
| Compound Name | 4-(2-bromoethoxy)-3,5-dichloro-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 572274 |
| Molecular Formula | C9H10BrCl2NO |
| Molecular Weight | 299.00 g/mol |
| Exact Mass | 296.93 |
| IUPAC Name | 4-(2-bromoethoxy)-3,5-dichloro-2,6-dimethylpyridine |
| SMILES | Cc1nc(C)c(Cl)c(OCCBr)c1Cl |
| InChI | InChI=1S/C9H10BrCl2NO/c1-5-7(11)9(14-4-3-10)8(12)6(2)13-5/h3-4H2,1-2H3 |
| InChIKey | QXGXBQSJXZMLKW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.00 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|