C16H13Cl2NO — CID 134066957
3,5-dichloro-2,6-dimethyl-4-(3-phenylprop-2-ynoxy)pyridine (PubChem CID 134066957) has the molecular formula C16H13Cl2NO and a molecular weight of 306.19 g/mol. Its IUPAC name is 3,5-dichloro-2,6-dimethyl-4-(3-phenylprop-2-ynoxy)pyridine.
| Compound Name | 3,5-dichloro-2,6-dimethyl-4-(3-phenylprop-2-ynoxy)pyridine |
|---|---|
| PubChem CID | 134066957 |
| Molecular Formula | C16H13Cl2NO |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3,5-dichloro-2,6-dimethyl-4-(3-phenylprop-2-ynoxy)pyridine |
| SMILES | Cc1nc(C)c(Cl)c(OCC#Cc2ccccc2)c1Cl |
| InChI | InChI=1S/C16H13Cl2NO/c1-11-14(17)16(15(18)12(2)19-11)20-10-6-9-13-7-4-3-5-8-13/h3-5,7-8H,10H2,1-2H3 |
| InChIKey | SBZQUKGRNLLLCL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|