C14H12Cl2FNO — CID 134064703
3,5-dichloro-4-[(2-fluorophenyl)methoxy]-2,6-dimethylpyridine (PubChem CID 134064703) has the molecular formula C14H12Cl2FNO and a molecular weight of 300.16 g/mol. Its IUPAC name is 3,5-dichloro-4-[(2-fluorophenyl)methoxy]-2,6-dimethylpyridine.
| Compound Name | 3,5-dichloro-4-[(2-fluorophenyl)methoxy]-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 134064703 |
| Molecular Formula | C14H12Cl2FNO |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 3,5-dichloro-4-[(2-fluorophenyl)methoxy]-2,6-dimethylpyridine |
| SMILES | Cc1nc(C)c(Cl)c(OCc2ccccc2F)c1Cl |
| InChI | InChI=1S/C14H12Cl2FNO/c1-8-12(15)14(13(16)9(2)18-8)19-7-10-5-3-4-6-11(10)17/h3-6H,7H2,1-2H3 |
| InChIKey | VYHBCHOHFMUJAR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |