C15H14Cl2N2O3 — CID 134064912
2-[(3,5-dichloro-2,6-dimethyl-4-pyridinyl)oxy]-N-(2-hydroxyphenyl)acetamide (PubChem CID 134064912) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2,6-dimethyl-4-pyridinyl)oxy]-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-[(3,5-dichloro-2,6-dimethyl-4-pyridinyl)oxy]-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 134064912 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-[(3,5-dichloro-2,6-dimethyl-4-pyridinyl)oxy]-N-(2-hydroxyphenyl)acetamide |
| SMILES | Cc1nc(C)c(Cl)c(OCC(=O)Nc2ccccc2O)c1Cl |
| InChI | InChI=1S/C15H14Cl2N2O3/c1-8-13(16)15(14(17)9(2)18-8)22-7-12(21)19-10-5-3-4-6-11(10)20/h3-6,20H,7H2,1-2H3,(H,19,21) |
| InChIKey | DVVRWALKGGFOTG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|