C7H5Cl4NO2 — CID 13029611
2-[(2,3,5,6-tetrachloro-4-pyridinyl)oxy]ethanol (PubChem CID 13029611) has the molecular formula C7H5Cl4NO2 and a molecular weight of 276.93 g/mol. Its IUPAC name is 2-[(2,3,5,6-tetrachloro-4-pyridinyl)oxy]ethanol.
| Compound Name | 2-[(2,3,5,6-tetrachloro-4-pyridinyl)oxy]ethanol |
|---|---|
| PubChem CID | 13029611 |
| Molecular Formula | C7H5Cl4NO2 |
| Molecular Weight | 276.93 g/mol |
| Exact Mass | 274.91 |
| IUPAC Name | 2-[(2,3,5,6-tetrachloro-4-pyridinyl)oxy]ethanol |
| SMILES | OCCOc1c(Cl)c(Cl)nc(Cl)c1Cl |
| InChI | InChI=1S/C7H5Cl4NO2/c8-3-5(14-2-1-13)4(9)7(11)12-6(3)10/h13H,1-2H2 |
| InChIKey | MDHKOPMXTUEYNI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.93 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|