About 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride
1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride (PubChem CID 170894141) has the molecular formula C13H19Cl3O
and a molecular weight of 297.65 g/mol. Its IUPAC name is 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride.
Molecular Properties
| Compound Name | 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride |
| PubChem CID | 170894141 |
| Molecular Formula | C13H19Cl3O |
| Molecular Weight | 297.65 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride |
| SMILES | CCCc1c(C)c(Cl)c(C)c(Cl)c1OCC.Cl |
| InChI | InChI=1S/C13H18Cl2O.ClH/c1-5-7-10-8(3)11(14)9(4)12(15)13(10)16-6-2;/h5-7H2,1-4H3;1H |
| InChIKey | FYGDMRIYOXOTOM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride?
The IUPAC name of 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride (CID 170894141) is 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride.
What is the SMILES notation for 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride?
The canonical SMILES for 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride is CCCc1c(C)c(Cl)c(C)c(Cl)c1OCC.Cl.
What is the InChIKey of 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride?
The InChIKey is FYGDMRIYOXOTOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl2O.ClH/c1-5-7-10-8(3)11(14)9(4)12(15)13(10)16-6-2;/h5-7H2,1-4H3;1H.
What are the key properties of 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride?
1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride has a molecular weight of 297.65 g/mol, XLogP of 5.38, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dichloro-2-ethoxy-4,6-dimethyl-3-propylbenzene;hydrochloride is sourced from PubChem (CID 170894141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).