C9H9LiN2O7S — CID 101305384
lithium 2,4,6-trimethyl-3,5-dinitrobenzenesulfonate (PubChem CID 101305384) has the molecular formula C9H9LiN2O7S and a molecular weight of 296.19 g/mol. Its IUPAC name is lithium 2,4,6-trimethyl-3,5-dinitrobenzenesulfonate.
| Compound Name | lithium 2,4,6-trimethyl-3,5-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 101305384 |
| Molecular Formula | C9H9LiN2O7S |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | lithium 2,4,6-trimethyl-3,5-dinitrobenzenesulfonate |
| SMILES | Cc1c([N+](=O)[O-])c(C)c(S(=O)(=O)[O-])c(C)c1[N+](=O)[O-].[Li+] |
| InChI | InChI=1S/C9H10N2O7S.Li/c1-4-7(10(12)13)5(2)9(19(16,17)18)6(3)8(4)11(14)15;/h1-3H3,(H,16,17,18);/q;+1/p-1 |
| InChIKey | CDTSKSSGVHLGJL-UHFFFAOYSA-M |
| XLogP | -1.66 |
| TPSA | 143.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|