C7H5N2NaO7S — CID 14323984
sodium 4-methyl-3,5-dinitrobenzenesulfonate (PubChem CID 14323984) has the molecular formula C7H5N2NaO7S and a molecular weight of 284.18 g/mol. Its IUPAC name is sodium 4-methyl-3,5-dinitrobenzenesulfonate.
| Compound Name | sodium 4-methyl-3,5-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 14323984 |
| Molecular Formula | C7H5N2NaO7S |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | sodium 4-methyl-3,5-dinitrobenzenesulfonate |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)[O-])cc1[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C7H6N2O7S.Na/c1-4-6(8(10)11)2-5(17(14,15)16)3-7(4)9(12)13;/h2-3H,1H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | YBCIFJCOPCRYJM-UHFFFAOYSA-M |
| XLogP | -2.28 |
| TPSA | 143.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|