C7H7N3O6S — CID 3715196
4-methylsulfonyl-2,6-dinitroaniline (PubChem CID 3715196) has the molecular formula C7H7N3O6S and a molecular weight of 261.21 g/mol. Its IUPAC name is 4-methylsulfonyl-2,6-dinitroaniline.
| Compound Name | 4-methylsulfonyl-2,6-dinitroaniline |
|---|---|
| PubChem CID | 3715196 |
| Molecular Formula | C7H7N3O6S |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 4-methylsulfonyl-2,6-dinitroaniline |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H7N3O6S/c1-17(15,16)4-2-5(9(11)12)7(8)6(3-4)10(13)14/h2-3H,8H2,1H3 |
| InChIKey | GZNCKEGJECDSPF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|