C21H27N9O12S3 — CID 161403923
5-methylsulfonylbenzene-1,2,3-triamine;4-methylsulfonyl-2,6-dinitroaniline;5-methylsulfonyl-3-nitrobenzene-1,2-diamine (PubChem CID 161403923) has the molecular formula C21H27N9O12S3 and a molecular weight of 693.70 g/mol. Its IUPAC name is 5-methylsulfonylbenzene-1,2,3-triamine;4-methylsulfonyl-2,6-dinitroaniline;5-methylsulfonyl-3-nitrobenzene-1,2-diamine.
| Compound Name | 5-methylsulfonylbenzene-1,2,3-triamine;4-methylsulfonyl-2,6-dinitroaniline;5-methylsulfonyl-3-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 161403923 |
| Molecular Formula | C21H27N9O12S3 |
| Molecular Weight | 693.70 g/mol |
| Exact Mass | 693.09 |
| IUPAC Name | 5-methylsulfonylbenzene-1,2,3-triamine;4-methylsulfonyl-2,6-dinitroaniline;5-methylsulfonyl-3-nitrobenzene-1,2-diamine |
| SMILES | CS(=O)(=O)c1cc(N)c(N)c(N)c1.CS(=O)(=O)c1cc(N)c(N)c([N+](=O)[O-])c1.CS(=O)(=O)c1cc([N+](=O)[O-])c(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H7N3O6S.C7H9N3O4S.C7H11N3O2S/c1-17(15,16)4-2-5(9(11)12)7(8)6(3-4)10(13)14;1-15(13,14)4-2-5(8)7(9)6(3-4)10(11)12;1-13(11,12)4-2-5(8)7(10)6(9)3-4/h2-3H,8H2,1H3;2-3H,8-9H2,1H3;2-3H,8-10H2,1H3 |
| InChIKey | VUOZFMKSBJOXLG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 387.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.70 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|