C8H11N3O5S — CID 54042342
3-amino-4-hydroxy-N,N-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 54042342) has the molecular formula C8H11N3O5S and a molecular weight of 261.26 g/mol. Its IUPAC name is 3-amino-4-hydroxy-N,N-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | 3-amino-4-hydroxy-N,N-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 54042342 |
| Molecular Formula | C8H11N3O5S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 3-amino-4-hydroxy-N,N-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(N)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H11N3O5S/c1-10(2)17(15,16)5-3-6(9)8(12)7(4-5)11(13)14/h3-4,12H,9H2,1-2H3 |
| InChIKey | LNFJEWHQPCSBID-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|