C8H13ClN2O3S — CID 3024163
4-amino-3-hydroxy-N,N-dimethylbenzenesulfonamide;hydrochloride (PubChem CID 3024163) has the molecular formula C8H13ClN2O3S and a molecular weight of 252.72 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N,N-dimethylbenzenesulfonamide;hydrochloride.
| Compound Name | 4-amino-3-hydroxy-N,N-dimethylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 3024163 |
| Molecular Formula | C8H13ClN2O3S |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 4-amino-3-hydroxy-N,N-dimethylbenzenesulfonamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1ccc(N)c(O)c1.Cl |
| InChI | InChI=1S/C8H12N2O3S.ClH/c1-10(2)14(12,13)6-3-4-7(9)8(11)5-6;/h3-5,11H,9H2,1-2H3;1H |
| InChIKey | QJOZXGDAAUQZEY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|