C12H13NO4S — CID 168524863
4-(furan-2-yl)-3-hydroxy-N,N-dimethylbenzenesulfonamide (PubChem CID 168524863) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-(furan-2-yl)-3-hydroxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-(furan-2-yl)-3-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 168524863 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-(furan-2-yl)-3-hydroxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2ccco2)c(O)c1 |
| InChI | InChI=1S/C12H13NO4S/c1-13(2)18(15,16)9-5-6-10(11(14)8-9)12-4-3-7-17-12/h3-8,14H,1-2H3 |
| InChIKey | RXUIEIOMEOKKFS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |